C31H37NO6 — CID 99735046
(1R,4R,5S,9S,10S,12R,13S,17S)-15-(4-carboxyphenyl)-5,9-dimethyl-14,16-dioxo-19-propan-2-yl-15-azapentacyclo[10.5.2.01,10.04,9.013,17]nonadec-18-ene-5-carboxylic acid (PubChem CID 99735046) has the molecular formula C31H37NO6 and a molecular weight of 519.64 g/mol. Its IUPAC name is (1R,4R,5S,9S,10S,12R,13S,17S)-15-(4-carboxyphenyl)-5,9-dimethyl-14,16-dioxo-19-propan-2-yl-15-azapentacyclo[10.5.2.01,10.04,9.013,17]nonadec-18-ene-5-carboxylic acid.
| Compound Name | (1R,4R,5S,9S,10S,12R,13S,17S)-15-(4-carboxyphenyl)-5,9-dimethyl-14,16-dioxo-19-propan-2-yl-15-azapentacyclo[10.5.2.01,10.04,9.013,17]nonadec-18-ene-5-carboxylic acid |
|---|---|
| PubChem CID | 99735046 |
| Molecular Formula | C31H37NO6 |
| Molecular Weight | 519.64 g/mol |
| Exact Mass | 519.26 |
| IUPAC Name | (1R,4R,5S,9S,10S,12R,13S,17S)-15-(4-carboxyphenyl)-5,9-dimethyl-14,16-dioxo-19-propan-2-yl-15-azapentacyclo[10.5.2.01,10.04,9.013,17]nonadec-18-ene-5-carboxylic acid |
| SMILES | CC(C)C1=C[C@]23CC[C@@H]4[C@@](C)(CCC[C@]4(C)C(=O)O)[C@@H]2C[C@@H]1[C@@H]1C(=O)N(c2ccc(C(=O)O)cc2)C(=O)[C@@H]13 |
| InChI | InChI=1S/C31H37NO6/c1-16(2)20-15-31-13-10-21-29(3,11-5-12-30(21,4)28(37)38)22(31)14-19(20)23-24(31)26(34)32(25(23)33)18-8-6-17(7-9-18)27(35)36/h6-9,15-16,19,21-24H,5,10-14H2,1-4H3,(H,35,36)(H,37,38)/t19-,21+,22-,23-,24+,29+,30-,31+/m0/s1 |
| InChIKey | WRODMTDCIBOFJL-KUTQYLHESA-N |
| XLogP | 5.40 |
| TPSA | 111.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.64 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|