C29H41Cl2NO3 — CID 134158962
(4R,5R,9R,10R,12R,13S,14S)-5,9-dimethyl-5-(piperidine-1-carbonyl)-16-propan-2-yltetracyclo[10.2.2.01,10.04,9]hexadec-15-ene-13,14-dicarbonyl chloride (PubChem CID 134158962) has the molecular formula C29H41Cl2NO3 and a molecular weight of 522.56 g/mol. Its IUPAC name is (4R,5R,9R,10R,12R,13S,14S)-5,9-dimethyl-5-(piperidine-1-carbonyl)-16-propan-2-yltetracyclo[10.2.2.01,10.04,9]hexadec-15-ene-13,14-dicarbonyl chloride.
| Compound Name | (4R,5R,9R,10R,12R,13S,14S)-5,9-dimethyl-5-(piperidine-1-carbonyl)-16-propan-2-yltetracyclo[10.2.2.01,10.04,9]hexadec-15-ene-13,14-dicarbonyl chloride |
|---|---|
| PubChem CID | 134158962 |
| Molecular Formula | C29H41Cl2NO3 |
| Molecular Weight | 522.56 g/mol |
| Exact Mass | 521.25 |
| IUPAC Name | (4R,5R,9R,10R,12R,13S,14S)-5,9-dimethyl-5-(piperidine-1-carbonyl)-16-propan-2-yltetracyclo[10.2.2.01,10.04,9]hexadec-15-ene-13,14-dicarbonyl chloride |
| SMILES | CC(C)C1=CC23CC[C@@H]4[C@](C)(CCC[C@@]4(C)C(=O)N4CCCCC4)[C@H]2C[C@@H]1[C@H](C(=O)Cl)[C@@H]3C(=O)Cl |
| InChI | InChI=1S/C29H41Cl2NO3/c1-17(2)19-16-29-12-9-20-27(3,21(29)15-18(19)22(24(30)33)23(29)25(31)34)10-8-11-28(20,4)26(35)32-13-6-5-7-14-32/h16-18,20-23H,5-15H2,1-4H3/t18-,20+,21+,22-,23+,27-,28+,29?/m0/s1 |
| InChIKey | AOLCIESJROQWKI-WQAYBPIGSA-N |
| XLogP | 6.59 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.56 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|