C30H43NO4 — CID 172676735
(1S,4R,5S,9R,10R,12R,13R,18R)-5,9-dimethyl-5-(morpholine-4-carbonyl)-20-propan-2-ylpentacyclo[10.6.2.01,10.04,9.013,18]icos-19-ene-14,17-dione (PubChem CID 172676735) has the molecular formula C30H43NO4 and a molecular weight of 481.68 g/mol. Its IUPAC name is (1S,4R,5S,9R,10R,12R,13R,18R)-5,9-dimethyl-5-(morpholine-4-carbonyl)-20-propan-2-ylpentacyclo[10.6.2.01,10.04,9.013,18]icos-19-ene-14,17-dione.
| Compound Name | (1S,4R,5S,9R,10R,12R,13R,18R)-5,9-dimethyl-5-(morpholine-4-carbonyl)-20-propan-2-ylpentacyclo[10.6.2.01,10.04,9.013,18]icos-19-ene-14,17-dione |
|---|---|
| PubChem CID | 172676735 |
| Molecular Formula | C30H43NO4 |
| Molecular Weight | 481.68 g/mol |
| Exact Mass | 481.32 |
| IUPAC Name | (1S,4R,5S,9R,10R,12R,13R,18R)-5,9-dimethyl-5-(morpholine-4-carbonyl)-20-propan-2-ylpentacyclo[10.6.2.01,10.04,9.013,18]icos-19-ene-14,17-dione |
| SMILES | CC(C)C1=C[C@@]23CC[C@@H]4[C@](C)(CCC[C@]4(C)C(=O)N4CCOCC4)[C@H]2C[C@@H]1[C@H]1C(=O)CCC(=O)[C@H]13 |
| InChI | InChI=1S/C30H43NO4/c1-18(2)20-17-30-11-8-23-28(3,9-5-10-29(23,4)27(34)31-12-14-35-15-13-31)24(30)16-19(20)25-21(32)6-7-22(33)26(25)30/h17-19,23-26H,5-16H2,1-4H3/t19-,23+,24+,25-,26+,28-,29-,30-/m0/s1 |
| InChIKey | DBDQZIPYCQNATQ-PNJVPEQOSA-N |
| XLogP | 4.83 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.68 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|