C32H47NO5 — CID 163319708
methyl (2R)-2-[[(1S,4R,9R,10R,12R,13R,18R)-5,9-dimethyl-14,17-dioxo-20-propan-2-ylpentacyclo[10.6.2.01,10.04,9.013,18]icos-19-ene-5-carbonyl]amino]-3-methylbutanoate (PubChem CID 163319708) has the molecular formula C32H47NO5 and a molecular weight of 525.73 g/mol. Its IUPAC name is methyl (2R)-2-[[(1S,4R,9R,10R,12R,13R,18R)-5,9-dimethyl-14,17-dioxo-20-propan-2-ylpentacyclo[10.6.2.01,10.04,9.013,18]icos-19-ene-5-carbonyl]amino]-3-methylbutanoate.
| Compound Name | methyl (2R)-2-[[(1S,4R,9R,10R,12R,13R,18R)-5,9-dimethyl-14,17-dioxo-20-propan-2-ylpentacyclo[10.6.2.01,10.04,9.013,18]icos-19-ene-5-carbonyl]amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 163319708 |
| Molecular Formula | C32H47NO5 |
| Molecular Weight | 525.73 g/mol |
| Exact Mass | 525.35 |
| IUPAC Name | methyl (2R)-2-[[(1S,4R,9R,10R,12R,13R,18R)-5,9-dimethyl-14,17-dioxo-20-propan-2-ylpentacyclo[10.6.2.01,10.04,9.013,18]icos-19-ene-5-carbonyl]amino]-3-methylbutanoate |
| SMILES | COC(=O)[C@H](NC(=O)C1(C)CCC[C@]2(C)[C@H]3C[C@H]4C(C(C)C)=C[C@]3(CC[C@@H]12)[C@@H]1C(=O)CCC(=O)[C@@H]14)C(C)C |
| InChI | InChI=1S/C32H47NO5/c1-17(2)20-16-32-14-11-23-30(5,24(32)15-19(20)25-21(34)9-10-22(35)26(25)32)12-8-13-31(23,6)29(37)33-27(18(3)4)28(36)38-7/h16-19,23-27H,8-15H2,1-7H3,(H,33,37)/t19-,23+,24+,25-,26+,27+,30-,31?,32-/m0/s1 |
| InChIKey | ZRRICRVDRTWWDE-HWPYAUJJSA-N |
| XLogP | 5.29 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.73 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|