C27H36O4 — CID 100882342
methyl (1S,4S,5R,9R,10S,12S,13R,18S)-5,9-dimethyl-14,17-dioxo-20-propan-2-ylpentacyclo[10.6.2.01,10.04,9.013,18]icosa-15,19-diene-5-carboxylate (PubChem CID 100882342) has the molecular formula C27H36O4 and a molecular weight of 424.58 g/mol. Its IUPAC name is methyl (1S,4S,5R,9R,10S,12S,13R,18S)-5,9-dimethyl-14,17-dioxo-20-propan-2-ylpentacyclo[10.6.2.01,10.04,9.013,18]icosa-15,19-diene-5-carboxylate.
| Compound Name | methyl (1S,4S,5R,9R,10S,12S,13R,18S)-5,9-dimethyl-14,17-dioxo-20-propan-2-ylpentacyclo[10.6.2.01,10.04,9.013,18]icosa-15,19-diene-5-carboxylate |
|---|---|
| PubChem CID | 100882342 |
| Molecular Formula | C27H36O4 |
| Molecular Weight | 424.58 g/mol |
| Exact Mass | 424.26 |
| IUPAC Name | methyl (1S,4S,5R,9R,10S,12S,13R,18S)-5,9-dimethyl-14,17-dioxo-20-propan-2-ylpentacyclo[10.6.2.01,10.04,9.013,18]icosa-15,19-diene-5-carboxylate |
| SMILES | COC(=O)[C@]1(C)CCC[C@]2(C)[C@@H]3C[C@@H]4C(C(C)C)=C[C@]3(CC[C@@H]21)[C@H]1C(=O)C=CC(=O)[C@H]41 |
| InChI | InChI=1S/C27H36O4/c1-15(2)17-14-27-12-9-20-25(3,10-6-11-26(20,4)24(30)31-5)21(27)13-16(17)22-18(28)7-8-19(29)23(22)27/h7-8,14-16,20-23H,6,9-13H2,1-5H3/t16-,20+,21+,22+,23+,25+,26-,27+/m1/s1 |
| InChIKey | UOJAWWVICMBLAC-USHIKHGISA-N |
| XLogP | 4.92 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.58 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|