C26H34O5 — CID 102249085
ethenyl (1S,4R,5R,9R,10R,12R,13R,17R)-5,9-dimethyl-14,16-dioxo-19-propan-2-yl-15-oxapentacyclo[10.5.2.01,10.04,9.013,17]nonadec-18-ene-5-carboxylate (PubChem CID 102249085) has the molecular formula C26H34O5 and a molecular weight of 426.55 g/mol. Its IUPAC name is ethenyl (1S,4R,5R,9R,10R,12R,13R,17R)-5,9-dimethyl-14,16-dioxo-19-propan-2-yl-15-oxapentacyclo[10.5.2.01,10.04,9.013,17]nonadec-18-ene-5-carboxylate.
| Compound Name | ethenyl (1S,4R,5R,9R,10R,12R,13R,17R)-5,9-dimethyl-14,16-dioxo-19-propan-2-yl-15-oxapentacyclo[10.5.2.01,10.04,9.013,17]nonadec-18-ene-5-carboxylate |
|---|---|
| PubChem CID | 102249085 |
| Molecular Formula | C26H34O5 |
| Molecular Weight | 426.55 g/mol |
| Exact Mass | 426.24 |
| IUPAC Name | ethenyl (1S,4R,5R,9R,10R,12R,13R,17R)-5,9-dimethyl-14,16-dioxo-19-propan-2-yl-15-oxapentacyclo[10.5.2.01,10.04,9.013,17]nonadec-18-ene-5-carboxylate |
| SMILES | C=COC(=O)[C@]1(C)CCC[C@]2(C)[C@H]3C[C@H]4C(C(C)C)=C[C@]3(CC[C@H]21)[C@@H]1C(=O)OC(=O)[C@@H]14 |
| InChI | InChI=1S/C26H34O5/c1-6-30-23(29)25(5)10-7-9-24(4)17(25)8-11-26-13-16(14(2)3)15(12-18(24)26)19-20(26)22(28)31-21(19)27/h6,13-15,17-20H,1,7-12H2,2-5H3/t15-,17+,18+,19+,20-,24-,25+,26-/m0/s1 |
| InChIKey | XPOUQOBPTUHHRC-MYKMSFAPSA-N |
| XLogP | 4.81 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.55 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|