C30H43NO5 — CID 122190717
methyl (2S)-2-[[(1S,4R,5R,9R,10R,12R,13R,18R)-5,9-dimethyl-14,17-dioxo-20-propan-2-ylpentacyclo[10.6.2.01,10.04,9.013,18]icos-19-ene-5-carbonyl]amino]propanoate (PubChem CID 122190717) has the molecular formula C30H43NO5 and a molecular weight of 497.68 g/mol. Its IUPAC name is methyl (2S)-2-[[(1S,4R,5R,9R,10R,12R,13R,18R)-5,9-dimethyl-14,17-dioxo-20-propan-2-ylpentacyclo[10.6.2.01,10.04,9.013,18]icos-19-ene-5-carbonyl]amino]propanoate.
| Compound Name | methyl (2S)-2-[[(1S,4R,5R,9R,10R,12R,13R,18R)-5,9-dimethyl-14,17-dioxo-20-propan-2-ylpentacyclo[10.6.2.01,10.04,9.013,18]icos-19-ene-5-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 122190717 |
| Molecular Formula | C30H43NO5 |
| Molecular Weight | 497.68 g/mol |
| Exact Mass | 497.31 |
| IUPAC Name | methyl (2S)-2-[[(1S,4R,5R,9R,10R,12R,13R,18R)-5,9-dimethyl-14,17-dioxo-20-propan-2-ylpentacyclo[10.6.2.01,10.04,9.013,18]icos-19-ene-5-carbonyl]amino]propanoate |
| SMILES | COC(=O)[C@H](C)NC(=O)[C@]1(C)CCC[C@]2(C)[C@H]3C[C@H]4C(C(C)C)=C[C@]3(CC[C@H]21)[C@@H]1C(=O)CCC(=O)[C@@H]14 |
| InChI | InChI=1S/C30H43NO5/c1-16(2)19-15-30-13-10-22-28(4,11-7-12-29(22,5)27(35)31-17(3)26(34)36-6)23(30)14-18(19)24-20(32)8-9-21(33)25(24)30/h15-18,22-25H,7-14H2,1-6H3,(H,31,35)/t17-,18-,22+,23+,24-,25+,28-,29+,30-/m0/s1 |
| InChIKey | MWGKPOYDTIEMHU-AXELNTHSSA-N |
| XLogP | 4.65 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.68 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|