C25H37NO — CID 139072989
[(1S,4aR,10aS)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]-piperidin-1-ylmethanone (PubChem CID 139072989) has the molecular formula C25H37NO and a molecular weight of 367.58 g/mol. Its IUPAC name is [(1S,4aR,10aS)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]-piperidin-1-ylmethanone.
| Compound Name | [(1S,4aR,10aS)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 139072989 |
| Molecular Formula | C25H37NO |
| Molecular Weight | 367.58 g/mol |
| Exact Mass | 367.29 |
| IUPAC Name | [(1S,4aR,10aS)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]-piperidin-1-ylmethanone |
| SMILES | CC(C)c1ccc2c(c1)CC[C@H]1[C@@]2(C)CCC[C@]1(C)C(=O)N1CCCCC1 |
| InChI | InChI=1S/C25H37NO/c1-18(2)19-9-11-21-20(17-19)10-12-22-24(21,3)13-8-14-25(22,4)23(27)26-15-6-5-7-16-26/h9,11,17-18,22H,5-8,10,12-16H2,1-4H3/t22-,24-,25-/m0/s1 |
| InChIKey | LGMSKFVHFRKJSU-HVCNVCAESA-N |
| XLogP | 5.83 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.58 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |