C40H54CaO4 — CID 155679271
calcium bis(1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate) (PubChem CID 155679271) has the molecular formula C40H54CaO4 and a molecular weight of 638.95 g/mol. Its IUPAC name is calcium bis(1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate).
| Compound Name | calcium bis(1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate) |
|---|---|
| PubChem CID | 155679271 |
| Molecular Formula | C40H54CaO4 |
| Molecular Weight | 638.95 g/mol |
| Exact Mass | 638.36 |
| IUPAC Name | calcium bis(1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate) |
| SMILES | CC(C)c1ccc2c(c1)CCC1C(C)(C(=O)[O-])CCCC21C.CC(C)c1ccc2c(c1)CCC1C(C)(C(=O)[O-])CCCC21C.[Ca+2] |
| InChI | InChI=1S/2C20H28O2.Ca/c2*1-13(2)14-6-8-16-15(12-14)7-9-17-19(16,3)10-5-11-20(17,4)18(21)22;/h2*6,8,12-13,17H,5,7,9-11H2,1-4H3,(H,21,22);/q;;+2/p-2 |
| InChIKey | WOHDYALFAWZMAA-UHFFFAOYSA-L |
| XLogP | 6.76 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.95 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |