C24H32N2OS — CID 22838676
(1S,4aS,10aR)-1,4a-dimethyl-N-(4-methyl-1,3-thiazol-2-yl)-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxamide (PubChem CID 22838676) has the molecular formula C24H32N2OS and a molecular weight of 396.60 g/mol. Its IUPAC name is (1S,4aS,10aR)-1,4a-dimethyl-N-(4-methyl-1,3-thiazol-2-yl)-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxamide.
| Compound Name | (1S,4aS,10aR)-1,4a-dimethyl-N-(4-methyl-1,3-thiazol-2-yl)-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxamide |
|---|---|
| PubChem CID | 22838676 |
| Molecular Formula | C24H32N2OS |
| Molecular Weight | 396.60 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | (1S,4aS,10aR)-1,4a-dimethyl-N-(4-methyl-1,3-thiazol-2-yl)-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxamide |
| SMILES | Cc1csc(NC(=O)[C@@]2(C)CCC[C@]3(C)c4ccc(C(C)C)cc4CC[C@@H]23)n1 |
| InChI | InChI=1S/C24H32N2OS/c1-15(2)17-7-9-19-18(13-17)8-10-20-23(19,4)11-6-12-24(20,5)21(27)26-22-25-16(3)14-28-22/h7,9,13-15,20H,6,8,10-12H2,1-5H3,(H,25,26,27)/t20-,23-,24+/m1/s1 |
| InChIKey | UAIBYKNEICCSNQ-HUVFLSCGSA-N |
| XLogP | 6.22 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.60 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |