C20H32N+ — CID 7067282
[(1R,4aR,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methylazanium (PubChem CID 7067282) has the molecular formula C20H32N+ and a molecular weight of 286.48 g/mol. Its IUPAC name is [(1R,4aR,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methylazanium.
| Compound Name | [(1R,4aR,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methylazanium |
|---|---|
| PubChem CID | 7067282 |
| Molecular Formula | C20H32N+ |
| Molecular Weight | 286.48 g/mol |
| Exact Mass | 286.25 |
| IUPAC Name | [(1R,4aR,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methylazanium |
| SMILES | CC(C)c1ccc2c(c1)CC[C@H]1[C@](C)(C[NH3+])CCC[C@@]21C |
| InChI | InChI=1S/C20H31N/c1-14(2)15-6-8-17-16(12-15)7-9-18-19(3,13-21)10-5-11-20(17,18)4/h6,8,12,14,18H,5,7,9-11,13,21H2,1-4H3/p+1/t18-,19-,20-/m0/s1 |
| InChIKey | JVVXZOOGOGPDRZ-UFYCRDLUSA-O |
| XLogP | 4.06 |
| TPSA | 27.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.48 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |