C23H33NO — CID 3750200
3-[(1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl)methoxy]propanenitrile (PubChem CID 3750200) has the molecular formula C23H33NO and a molecular weight of 339.52 g/mol. Its IUPAC name is 3-[(1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl)methoxy]propanenitrile.
| Compound Name | 3-[(1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl)methoxy]propanenitrile |
|---|---|
| PubChem CID | 3750200 |
| Molecular Formula | C23H33NO |
| Molecular Weight | 339.52 g/mol |
| Exact Mass | 339.26 |
| IUPAC Name | 3-[(1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl)methoxy]propanenitrile |
| SMILES | CC(C)c1ccc2c(c1)CCC1C(C)(COCCC#N)CCCC21C |
| InChI | InChI=1S/C23H33NO/c1-17(2)18-7-9-20-19(15-18)8-10-21-22(3,16-25-14-6-13-24)11-5-12-23(20,21)4/h7,9,15,17,21H,5-6,8,10-12,14,16H2,1-4H3 |
| InChIKey | KNDKKHHPKWWADZ-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.52 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|