C43H69N — CID 159939808
(1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl)methanamine;1,1,4a-trimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene;propane (PubChem CID 159939808) has the molecular formula C43H69N and a molecular weight of 600.03 g/mol. Its IUPAC name is (1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl)methanamine;1,1,4a-trimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene;propane.
| Compound Name | (1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl)methanamine;1,1,4a-trimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene;propane |
|---|---|
| PubChem CID | 159939808 |
| Molecular Formula | C43H69N |
| Molecular Weight | 600.03 g/mol |
| Exact Mass | 599.54 |
| IUPAC Name | (1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl)methanamine;1,1,4a-trimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene;propane |
| SMILES | CC(C)c1ccc2c(c1)CCC1C(C)(C)CCCC21C.CC(C)c1ccc2c(c1)CCC1C(C)(CN)CCCC21C.CCC |
| InChI | InChI=1S/C20H31N.C20H30.C3H8/c1-14(2)15-6-8-17-16(12-15)7-9-18-19(3,13-21)10-5-11-20(17,18)4;1-14(2)15-7-9-17-16(13-15)8-10-18-19(3,4)11-6-12-20(17,18)5;1-3-2/h6,8,12,14,18H,5,7,9-11,13,21H2,1-4H3;7,9,13-14,18H,6,8,10-12H2,1-5H3;3H2,1-2H3 |
| InChIKey | OASPGQGBOOIQCY-UHFFFAOYSA-N |
| XLogP | 12.04 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.03 |
| LogP ≤ 5 | 12.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |