C22H31N3S — CID 123611925
5-[[(1R,4aS,10aS)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methyl]-1,3,4-thiadiazol-2-amine (PubChem CID 123611925) has the molecular formula C22H31N3S and a molecular weight of 369.58 g/mol. Its IUPAC name is 5-[[(1R,4aS,10aS)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methyl]-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-[[(1R,4aS,10aS)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methyl]-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 123611925 |
| Molecular Formula | C22H31N3S |
| Molecular Weight | 369.58 g/mol |
| Exact Mass | 369.22 |
| IUPAC Name | 5-[[(1R,4aS,10aS)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methyl]-1,3,4-thiadiazol-2-amine |
| SMILES | CC(C)c1ccc2c(c1)CC[C@H]1[C@@](C)(Cc3nnc(N)s3)CCC[C@]21C |
| InChI | InChI=1S/C22H31N3S/c1-14(2)15-6-8-17-16(12-15)7-9-18-21(3,10-5-11-22(17,18)4)13-19-24-25-20(23)26-19/h6,8,12,14,18H,5,7,9-11,13H2,1-4H3,(H2,23,25)/t18-,21+,22+/m0/s1 |
| InChIKey | IJNXCVLVAYODRB-VLCRHTCISA-N |
| XLogP | 5.50 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.58 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |