C23H38ClN — CID 53400170
N-[(1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl)methyl]propan-2-amine;hydrochloride (PubChem CID 53400170) has the molecular formula C23H38ClN and a molecular weight of 364.02 g/mol. Its IUPAC name is N-[(1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl)methyl]propan-2-amine;hydrochloride.
| Compound Name | N-[(1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl)methyl]propan-2-amine;hydrochloride |
|---|---|
| PubChem CID | 53400170 |
| Molecular Formula | C23H38ClN |
| Molecular Weight | 364.02 g/mol |
| Exact Mass | 363.27 |
| IUPAC Name | N-[(1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl)methyl]propan-2-amine;hydrochloride |
| SMILES | CC(C)NCC1(C)CCCC2(C)c3ccc(C(C)C)cc3CCC12.Cl |
| InChI | InChI=1S/C23H37N.ClH/c1-16(2)18-8-10-20-19(14-18)9-11-21-22(5,15-24-17(3)4)12-7-13-23(20,21)6;/h8,10,14,16-17,21,24H,7,9,11-13,15H2,1-6H3;1H |
| InChIKey | IERXNUYVCWUGCH-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.02 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |