C27H35ClN2O — CID 3676352
1-[(1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl)methyl]-3-(4-chlorophenyl)urea (PubChem CID 3676352) has the molecular formula C27H35ClN2O and a molecular weight of 439.04 g/mol. Its IUPAC name is 1-[(1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl)methyl]-3-(4-chlorophenyl)urea.
| Compound Name | 1-[(1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl)methyl]-3-(4-chlorophenyl)urea |
|---|---|
| PubChem CID | 3676352 |
| Molecular Formula | C27H35ClN2O |
| Molecular Weight | 439.04 g/mol |
| Exact Mass | 438.24 |
| IUPAC Name | 1-[(1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl)methyl]-3-(4-chlorophenyl)urea |
| SMILES | CC(C)c1ccc2c(c1)CCC1C(C)(CNC(=O)Nc3ccc(Cl)cc3)CCCC21C |
| InChI | InChI=1S/C27H35ClN2O/c1-18(2)19-6-12-23-20(16-19)7-13-24-26(3,14-5-15-27(23,24)4)17-29-25(31)30-22-10-8-21(28)9-11-22/h6,8-12,16,18,24H,5,7,13-15,17H2,1-4H3,(H2,29,30,31) |
| InChIKey | BBKLOKKZPCGLMA-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.04 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |