C34H40ClNO — CID 3922218
N-[(1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl)methyl]-N-[(4-chlorophenyl)methyl]benzamide (PubChem CID 3922218) has the molecular formula C34H40ClNO and a molecular weight of 514.15 g/mol. Its IUPAC name is N-[(1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl)methyl]-N-[(4-chlorophenyl)methyl]benzamide.
| Compound Name | N-[(1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl)methyl]-N-[(4-chlorophenyl)methyl]benzamide |
|---|---|
| PubChem CID | 3922218 |
| Molecular Formula | C34H40ClNO |
| Molecular Weight | 514.15 g/mol |
| Exact Mass | 513.28 |
| IUPAC Name | N-[(1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl)methyl]-N-[(4-chlorophenyl)methyl]benzamide |
| SMILES | CC(C)c1ccc2c(c1)CCC1C(C)(CN(Cc3ccc(Cl)cc3)C(=O)c3ccccc3)CCCC21C |
| InChI | InChI=1S/C34H40ClNO/c1-24(2)27-13-17-30-28(21-27)14-18-31-33(3,19-8-20-34(30,31)4)23-36(22-25-11-15-29(35)16-12-25)32(37)26-9-6-5-7-10-26/h5-7,9-13,15-17,21,24,31H,8,14,18-20,22-23H2,1-4H3 |
| InChIKey | CXXDOZFJMYHLHO-UHFFFAOYSA-N |
| XLogP | 8.82 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.15 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |