C25H35N3O — CID 155560930
N-[[(1R,4aS,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methyl]-3-methylimidazole-4-carboxamide (PubChem CID 155560930) has the molecular formula C25H35N3O and a molecular weight of 393.58 g/mol. Its IUPAC name is N-[[(1R,4aS,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methyl]-3-methylimidazole-4-carboxamide.
| Compound Name | N-[[(1R,4aS,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methyl]-3-methylimidazole-4-carboxamide |
|---|---|
| PubChem CID | 155560930 |
| Molecular Formula | C25H35N3O |
| Molecular Weight | 393.58 g/mol |
| Exact Mass | 393.28 |
| IUPAC Name | N-[[(1R,4aS,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methyl]-3-methylimidazole-4-carboxamide |
| SMILES | CC(C)c1ccc2c(c1)CC[C@H]1[C@](C)(CNC(=O)c3cncn3C)CCC[C@]21C |
| InChI | InChI=1S/C25H35N3O/c1-17(2)18-7-9-20-19(13-18)8-10-22-24(3,11-6-12-25(20,22)4)15-27-23(29)21-14-26-16-28(21)5/h7,9,13-14,16-17,22H,6,8,10-12,15H2,1-5H3,(H,27,29)/t22-,24-,25+/m0/s1 |
| InChIKey | VOVVGGQZDFWSSH-ZKMPZPQNSA-N |
| XLogP | 4.98 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.58 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |