C28H39NO — CID 122190107
N-[[(1R,4aS,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 122190107) has the molecular formula C28H39NO and a molecular weight of 405.63 g/mol. Its IUPAC name is N-[[(1R,4aS,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | N-[[(1R,4aS,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 122190107 |
| Molecular Formula | C28H39NO |
| Molecular Weight | 405.63 g/mol |
| Exact Mass | 405.30 |
| IUPAC Name | N-[[(1R,4aS,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | CC(C)c1ccc2c(c1)CC[C@H]1[C@](C)(CNC(=O)C3CC4C=CC3C4)CCC[C@]21C |
| InChI | InChI=1S/C28H39NO/c1-18(2)20-8-10-24-22(16-20)9-11-25-27(3,12-5-13-28(24,25)4)17-29-26(30)23-15-19-6-7-21(23)14-19/h6-8,10,16,18-19,21,23,25H,5,9,11-15,17H2,1-4H3,(H,29,30)/t19?,21?,23?,25-,27-,28+/m0/s1 |
| InChIKey | MILMUQAPEJSUCG-FUGBVQFVSA-N |
| XLogP | 6.15 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.63 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|