C28H39NO3 — CID 139190244
(1R,4aS,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate;[(2S)-2-hydroxy-2-phenylethyl]azanium (PubChem CID 139190244) has the molecular formula C28H39NO3 and a molecular weight of 437.62 g/mol. Its IUPAC name is (1R,4aS,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate;[(2S)-2-hydroxy-2-phenylethyl]azanium.
| Compound Name | (1R,4aS,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate;[(2S)-2-hydroxy-2-phenylethyl]azanium |
|---|---|
| PubChem CID | 139190244 |
| Molecular Formula | C28H39NO3 |
| Molecular Weight | 437.62 g/mol |
| Exact Mass | 437.29 |
| IUPAC Name | (1R,4aS,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate;[(2S)-2-hydroxy-2-phenylethyl]azanium |
| SMILES | CC(C)c1ccc2c(c1)CC[C@H]1[C@](C)(C(=O)[O-])CCC[C@]21C.[NH3+]C[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C20H28O2.C8H11NO/c1-13(2)14-6-8-16-15(12-14)7-9-17-19(16,3)10-5-11-20(17,4)18(21)22;9-6-8(10)7-4-2-1-3-5-7/h6,8,12-13,17H,5,7,9-11H2,1-4H3,(H,21,22);1-5,8,10H,6,9H2/t17-,19-,20-;8-/m11/s1 |
| InChIKey | YPTYMBMGYZQLEE-IGOJDJTCSA-N |
| XLogP | 3.53 |
| TPSA | 88.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.62 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |