C28H37NO2 — CID 7424897
4-[[[(1R,4aS,10aS)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methylazaniumyl]methyl]benzoate (PubChem CID 7424897) has the molecular formula C28H37NO2 and a molecular weight of 419.61 g/mol. Its IUPAC name is 4-[[[(1R,4aS,10aS)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methylazaniumyl]methyl]benzoate.
| Compound Name | 4-[[[(1R,4aS,10aS)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methylazaniumyl]methyl]benzoate |
|---|---|
| PubChem CID | 7424897 |
| Molecular Formula | C28H37NO2 |
| Molecular Weight | 419.61 g/mol |
| Exact Mass | 419.28 |
| IUPAC Name | 4-[[[(1R,4aS,10aS)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methylazaniumyl]methyl]benzoate |
| SMILES | CC(C)c1ccc2c(c1)CC[C@@H]1[C@](C)(C[NH2+]Cc3ccc(C(=O)[O-])cc3)CCC[C@]21C |
| InChI | InChI=1S/C28H37NO2/c1-19(2)22-10-12-24-23(16-22)11-13-25-27(3,14-5-15-28(24,25)4)18-29-17-20-6-8-21(9-7-20)26(30)31/h6-10,12,16,19,25,29H,5,11,13-15,17-18H2,1-4H3,(H,30,31)/t25-,27+,28-/m1/s1 |
| InChIKey | CQAXFWGFFLQWMP-FPNNDXFKSA-N |
| XLogP | 3.95 |
| TPSA | 56.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.61 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |