C25H39NO2 — CID 42601332
(1R,5R,9S,13S)-5,9,13-trimethyl-5-(piperidine-1-carbonyl)tetracyclo[11.2.1.01,10.04,9]hexadecan-14-one (PubChem CID 42601332) has the molecular formula C25H39NO2 and a molecular weight of 385.59 g/mol. Its IUPAC name is (1R,5R,9S,13S)-5,9,13-trimethyl-5-(piperidine-1-carbonyl)tetracyclo[11.2.1.01,10.04,9]hexadecan-14-one.
| Compound Name | (1R,5R,9S,13S)-5,9,13-trimethyl-5-(piperidine-1-carbonyl)tetracyclo[11.2.1.01,10.04,9]hexadecan-14-one |
|---|---|
| PubChem CID | 42601332 |
| Molecular Formula | C25H39NO2 |
| Molecular Weight | 385.59 g/mol |
| Exact Mass | 385.30 |
| IUPAC Name | (1R,5R,9S,13S)-5,9,13-trimethyl-5-(piperidine-1-carbonyl)tetracyclo[11.2.1.01,10.04,9]hexadecan-14-one |
| SMILES | C[C@@]12CCC3[C@@](CCC4[C@@]3(C)CCC[C@@]4(C)C(=O)N3CCCCC3)(CC1=O)C2 |
| InChI | InChI=1S/C25H39NO2/c1-22-12-8-19-23(2)10-7-11-24(3,21(28)26-14-5-4-6-15-26)18(23)9-13-25(19,17-22)16-20(22)27/h18-19H,4-17H2,1-3H3/t18?,19?,22-,23+,24+,25-/m0/s1 |
| InChIKey | SZNJTJJGKJPTEQ-NFGKALHASA-N |
| XLogP | 5.37 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.59 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |