C24H39NO2 — CID 42601326
(1R,5R,9S,13S)-N-tert-butyl-5,9,13-trimethyl-14-oxotetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxamide (PubChem CID 42601326) has the molecular formula C24H39NO2 and a molecular weight of 373.58 g/mol. Its IUPAC name is (1R,5R,9S,13S)-N-tert-butyl-5,9,13-trimethyl-14-oxotetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxamide.
| Compound Name | (1R,5R,9S,13S)-N-tert-butyl-5,9,13-trimethyl-14-oxotetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxamide |
|---|---|
| PubChem CID | 42601326 |
| Molecular Formula | C24H39NO2 |
| Molecular Weight | 373.58 g/mol |
| Exact Mass | 373.30 |
| IUPAC Name | (1R,5R,9S,13S)-N-tert-butyl-5,9,13-trimethyl-14-oxotetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxamide |
| SMILES | CC(C)(C)NC(=O)[C@]1(C)CCC[C@@]2(C)C3CC[C@@]4(C)C[C@]3(CCC21)CC4=O |
| InChI | InChI=1S/C24H39NO2/c1-20(2,3)25-19(27)23(6)11-7-10-22(5)16(23)9-13-24-14-18(26)21(4,15-24)12-8-17(22)24/h16-17H,7-15H2,1-6H3,(H,25,27)/t16?,17?,21-,22+,23+,24-/m0/s1 |
| InChIKey | NEOONGYNIJYGRY-VAVNPHBKSA-N |
| XLogP | 5.27 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.58 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |