C21H34N2O2 — CID 76900212
1-methyl-3-[(1R,4S,5R,9S,10R,13S)-5,9,13-trimethyl-14-oxo-5-tetracyclo[11.2.1.01,10.04,9]hexadecanyl]urea (PubChem CID 76900212) has the molecular formula C21H34N2O2 and a molecular weight of 346.52 g/mol. Its IUPAC name is 1-methyl-3-[(1R,4S,5R,9S,10R,13S)-5,9,13-trimethyl-14-oxo-5-tetracyclo[11.2.1.01,10.04,9]hexadecanyl]urea.
| Compound Name | 1-methyl-3-[(1R,4S,5R,9S,10R,13S)-5,9,13-trimethyl-14-oxo-5-tetracyclo[11.2.1.01,10.04,9]hexadecanyl]urea |
|---|---|
| PubChem CID | 76900212 |
| Molecular Formula | C21H34N2O2 |
| Molecular Weight | 346.52 g/mol |
| Exact Mass | 346.26 |
| IUPAC Name | 1-methyl-3-[(1R,4S,5R,9S,10R,13S)-5,9,13-trimethyl-14-oxo-5-tetracyclo[11.2.1.01,10.04,9]hexadecanyl]urea |
| SMILES | CNC(=O)N[C@]1(C)CCC[C@@]2(C)[C@@H]3CC[C@@]4(C)C[C@]3(CC[C@@H]21)CC4=O |
| InChI | InChI=1S/C21H34N2O2/c1-18-10-6-15-19(2)8-5-9-20(3,23-17(25)22-4)14(19)7-11-21(15,13-18)12-16(18)24/h14-15H,5-13H2,1-4H3,(H2,22,23,25)/t14-,15-,18-,19+,20+,21-/m0/s1 |
| InChIKey | YAAZCYZLITZGTA-XNRDYXSJSA-N |
| XLogP | 4.04 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.52 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |