C27H44N2O2 — CID 177493405
(1R,4S,5R,9S,10R,13S)-5,9,13-trimethyl-14-oxo-N-(2-piperidin-1-ylethyl)tetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxamide (PubChem CID 177493405) has the molecular formula C27H44N2O2 and a molecular weight of 428.66 g/mol. Its IUPAC name is (1R,4S,5R,9S,10R,13S)-5,9,13-trimethyl-14-oxo-N-(2-piperidin-1-ylethyl)tetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxamide.
| Compound Name | (1R,4S,5R,9S,10R,13S)-5,9,13-trimethyl-14-oxo-N-(2-piperidin-1-ylethyl)tetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxamide |
|---|---|
| PubChem CID | 177493405 |
| Molecular Formula | C27H44N2O2 |
| Molecular Weight | 428.66 g/mol |
| Exact Mass | 428.34 |
| IUPAC Name | (1R,4S,5R,9S,10R,13S)-5,9,13-trimethyl-14-oxo-N-(2-piperidin-1-ylethyl)tetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxamide |
| SMILES | C[C@@]12CC[C@@H]3[C@@](CC[C@H]4[C@@]3(C)CCC[C@@]4(C)C(=O)NCCN3CCCCC3)(CC1=O)C2 |
| InChI | InChI=1S/C27H44N2O2/c1-24-12-8-21-25(2)10-7-11-26(3,20(25)9-13-27(21,19-24)18-22(24)30)23(31)28-14-17-29-15-5-4-6-16-29/h20-21H,4-19H2,1-3H3,(H,28,31)/t20-,21-,24-,25+,26+,27-/m0/s1 |
| InChIKey | YAQNDEQJFGQJDO-FIVJYGDRSA-N |
| XLogP | 4.96 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.66 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |