C41H50BrO3P — CID 122180224
triphenyl-[3-[(1R,4S,5R,9S,10R,13S)-5,9,13-trimethyl-14-oxotetracyclo[11.2.1.01,10.04,9]hexadecane-5-carbonyl]oxypropyl]phosphanium bromide (PubChem CID 122180224) has the molecular formula C41H50BrO3P and a molecular weight of 701.73 g/mol. Its IUPAC name is triphenyl-[3-[(1R,4S,5R,9S,10R,13S)-5,9,13-trimethyl-14-oxotetracyclo[11.2.1.01,10.04,9]hexadecane-5-carbonyl]oxypropyl]phosphanium bromide.
| Compound Name | triphenyl-[3-[(1R,4S,5R,9S,10R,13S)-5,9,13-trimethyl-14-oxotetracyclo[11.2.1.01,10.04,9]hexadecane-5-carbonyl]oxypropyl]phosphanium bromide |
|---|---|
| PubChem CID | 122180224 |
| Molecular Formula | C41H50BrO3P |
| Molecular Weight | 701.73 g/mol |
| Exact Mass | 700.27 |
| IUPAC Name | triphenyl-[3-[(1R,4S,5R,9S,10R,13S)-5,9,13-trimethyl-14-oxotetracyclo[11.2.1.01,10.04,9]hexadecane-5-carbonyl]oxypropyl]phosphanium bromide |
| SMILES | C[C@@]12CC[C@@H]3[C@@](CC[C@H]4[C@@]3(C)CCC[C@@]4(C)C(=O)OCCC[P+](c3ccccc3)(c3ccccc3)c3ccccc3)(CC1=O)C2.[Br-] |
| InChI | InChI=1S/C41H50O3P.BrH/c1-38-25-21-35-39(2)23-13-24-40(3,34(39)22-26-41(35,30-38)29-36(38)42)37(43)44-27-14-28-45(31-15-7-4-8-16-31,32-17-9-5-10-18-32)33-19-11-6-12-20-33;/h4-12,15-20,34-35H,13-14,21-30H2,1-3H3;1H/q+1;/p-1/t34-,35-,38-,39+,40+,41-;/m0./s1 |
| InChIKey | WNDPNFIGPNNKAW-IWTAHXHMSA-M |
| XLogP | 5.29 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.73 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|