C34H60NO6+ — CID 122180223
triethyl-[2-[2-[2-[2-[(1R,4S,5R,9S,10R,13S)-5,9,13-trimethyl-14-oxotetracyclo[11.2.1.01,10.04,9]hexadecane-5-carbonyl]oxyethoxy]ethoxy]ethoxy]ethyl]azanium (PubChem CID 122180223) has the molecular formula C34H60NO6+ and a molecular weight of 578.86 g/mol. Its IUPAC name is triethyl-[2-[2-[2-[2-[(1R,4S,5R,9S,10R,13S)-5,9,13-trimethyl-14-oxotetracyclo[11.2.1.01,10.04,9]hexadecane-5-carbonyl]oxyethoxy]ethoxy]ethoxy]ethyl]azanium.
| Compound Name | triethyl-[2-[2-[2-[2-[(1R,4S,5R,9S,10R,13S)-5,9,13-trimethyl-14-oxotetracyclo[11.2.1.01,10.04,9]hexadecane-5-carbonyl]oxyethoxy]ethoxy]ethoxy]ethyl]azanium |
|---|---|
| PubChem CID | 122180223 |
| Molecular Formula | C34H60NO6+ |
| Molecular Weight | 578.86 g/mol |
| Exact Mass | 578.44 |
| IUPAC Name | triethyl-[2-[2-[2-[2-[(1R,4S,5R,9S,10R,13S)-5,9,13-trimethyl-14-oxotetracyclo[11.2.1.01,10.04,9]hexadecane-5-carbonyl]oxyethoxy]ethoxy]ethoxy]ethyl]azanium |
| SMILES | CC[N+](CC)(CC)CCOCCOCCOCCOC(=O)[C@]1(C)CCC[C@@]2(C)[C@@H]3CC[C@@]4(C)C[C@]3(CC[C@@H]21)CC4=O |
| InChI | InChI=1S/C34H60NO6/c1-7-35(8-2,9-3)17-18-38-19-20-39-21-22-40-23-24-41-30(37)33(6)14-10-13-32(5)27(33)12-16-34-25-29(36)31(4,26-34)15-11-28(32)34/h27-28H,7-26H2,1-6H3/q+1/t27-,28-,31-,32+,33+,34-/m0/s1 |
| InChIKey | DNJLDXOOAJHLGN-IPWJYROCSA-N |
| XLogP | 5.83 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.86 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|