C44H56O3P+ — CID 122180227
triphenyl-[6-[(1R,4S,5R,9S,10R,13S)-5,9,13-trimethyl-14-oxotetracyclo[11.2.1.01,10.04,9]hexadecane-5-carbonyl]oxyhexyl]phosphanium (PubChem CID 122180227) has the molecular formula C44H56O3P+ and a molecular weight of 663.90 g/mol. Its IUPAC name is triphenyl-[6-[(1R,4S,5R,9S,10R,13S)-5,9,13-trimethyl-14-oxotetracyclo[11.2.1.01,10.04,9]hexadecane-5-carbonyl]oxyhexyl]phosphanium.
| Compound Name | triphenyl-[6-[(1R,4S,5R,9S,10R,13S)-5,9,13-trimethyl-14-oxotetracyclo[11.2.1.01,10.04,9]hexadecane-5-carbonyl]oxyhexyl]phosphanium |
|---|---|
| PubChem CID | 122180227 |
| Molecular Formula | C44H56O3P+ |
| Molecular Weight | 663.90 g/mol |
| Exact Mass | 663.40 |
| IUPAC Name | triphenyl-[6-[(1R,4S,5R,9S,10R,13S)-5,9,13-trimethyl-14-oxotetracyclo[11.2.1.01,10.04,9]hexadecane-5-carbonyl]oxyhexyl]phosphanium |
| SMILES | C[C@@]12CC[C@@H]3[C@@](CC[C@H]4[C@@]3(C)CCC[C@@]4(C)C(=O)OCCCCCC[P+](c3ccccc3)(c3ccccc3)c3ccccc3)(CC1=O)C2 |
| InChI | InChI=1S/C44H56O3P/c1-41-28-24-38-42(2)26-17-27-43(3,37(42)25-29-44(38,33-41)32-39(41)45)40(46)47-30-15-4-5-16-31-48(34-18-9-6-10-19-34,35-20-11-7-12-21-35)36-22-13-8-14-23-36/h6-14,18-23,37-38H,4-5,15-17,24-33H2,1-3H3/q+1/t37-,38-,41-,42+,43+,44-/m0/s1 |
| InChIKey | LVZVVUUKQOBPNV-XJVDRXDBSA-N |
| XLogP | 9.46 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.90 |
| LogP ≤ 5 | 9.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|