C31H46BrNO3 — CID 90667346
benzyl-dimethyl-[2-[(1R,4S,5R,9S,10R,13S)-5,9,13-trimethyl-14-oxotetracyclo[11.2.1.01,10.04,9]hexadecane-5-carbonyl]oxyethyl]azanium bromide (PubChem CID 90667346) has the molecular formula C31H46BrNO3 and a molecular weight of 560.62 g/mol. Its IUPAC name is benzyl-dimethyl-[2-[(1R,4S,5R,9S,10R,13S)-5,9,13-trimethyl-14-oxotetracyclo[11.2.1.01,10.04,9]hexadecane-5-carbonyl]oxyethyl]azanium bromide.
| Compound Name | benzyl-dimethyl-[2-[(1R,4S,5R,9S,10R,13S)-5,9,13-trimethyl-14-oxotetracyclo[11.2.1.01,10.04,9]hexadecane-5-carbonyl]oxyethyl]azanium bromide |
|---|---|
| PubChem CID | 90667346 |
| Molecular Formula | C31H46BrNO3 |
| Molecular Weight | 560.62 g/mol |
| Exact Mass | 559.27 |
| IUPAC Name | benzyl-dimethyl-[2-[(1R,4S,5R,9S,10R,13S)-5,9,13-trimethyl-14-oxotetracyclo[11.2.1.01,10.04,9]hexadecane-5-carbonyl]oxyethyl]azanium bromide |
| SMILES | C[C@@]12CC[C@@H]3[C@@](CC[C@H]4[C@@]3(C)CCC[C@@]4(C)C(=O)OCC[N+](C)(C)Cc3ccccc3)(CC1=O)C2.[Br-] |
| InChI | InChI=1S/C31H46NO3.BrH/c1-28-16-12-25-29(2)14-9-15-30(3,24(29)13-17-31(25,22-28)20-26(28)33)27(34)35-19-18-32(4,5)21-23-10-7-6-8-11-23;/h6-8,10-11,24-25H,9,12-22H2,1-5H3;1H/q+1;/p-1/t24-,25-,28-,29+,30+,31-;/m0./s1 |
| InChIKey | AYGAVXJDEXPGHJ-DBIONIRXSA-M |
| XLogP | 3.18 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.62 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|