C27H37NO2 — CID 42601330
(1R,5R,9S,13S)-N-benzyl-5,9,13-trimethyl-14-oxotetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxamide (PubChem CID 42601330) has the molecular formula C27H37NO2 and a molecular weight of 407.60 g/mol. Its IUPAC name is (1R,5R,9S,13S)-N-benzyl-5,9,13-trimethyl-14-oxotetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxamide.
| Compound Name | (1R,5R,9S,13S)-N-benzyl-5,9,13-trimethyl-14-oxotetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxamide |
|---|---|
| PubChem CID | 42601330 |
| Molecular Formula | C27H37NO2 |
| Molecular Weight | 407.60 g/mol |
| Exact Mass | 407.28 |
| IUPAC Name | (1R,5R,9S,13S)-N-benzyl-5,9,13-trimethyl-14-oxotetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxamide |
| SMILES | C[C@@]12CCC3[C@@](CCC4[C@@]3(C)CCC[C@@]4(C)C(=O)NCc3ccccc3)(CC1=O)C2 |
| InChI | InChI=1S/C27H37NO2/c1-24-14-10-21-25(2)12-7-13-26(3,23(30)28-17-19-8-5-4-6-9-19)20(25)11-15-27(21,18-24)16-22(24)29/h4-6,8-9,20-21H,7,10-18H2,1-3H3,(H,28,30)/t20?,21?,24-,25+,26+,27-/m0/s1 |
| InChIKey | XXTWNNJUTAYEDM-HLJXVDICSA-N |
| XLogP | 5.67 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.60 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |