C28H38N4O2 — CID 122528712
(1R,4R,9R,10S,13R)-5-(azidomethyl)-N-benzyl-5,9,13-trimethyl-14-oxotetracyclo[11.2.1.01,10.04,9]hexadecane-6-carboxamide (PubChem CID 122528712) has the molecular formula C28H38N4O2 and a molecular weight of 462.64 g/mol. Its IUPAC name is (1R,4R,9R,10S,13R)-5-(azidomethyl)-N-benzyl-5,9,13-trimethyl-14-oxotetracyclo[11.2.1.01,10.04,9]hexadecane-6-carboxamide.
| Compound Name | (1R,4R,9R,10S,13R)-5-(azidomethyl)-N-benzyl-5,9,13-trimethyl-14-oxotetracyclo[11.2.1.01,10.04,9]hexadecane-6-carboxamide |
|---|---|
| PubChem CID | 122528712 |
| Molecular Formula | C28H38N4O2 |
| Molecular Weight | 462.64 g/mol |
| Exact Mass | 462.30 |
| IUPAC Name | (1R,4R,9R,10S,13R)-5-(azidomethyl)-N-benzyl-5,9,13-trimethyl-14-oxotetracyclo[11.2.1.01,10.04,9]hexadecane-6-carboxamide |
| SMILES | CC1(CN=[N+]=[N-])C(C(=O)NCc2ccccc2)CC[C@@]2(C)[C@H]1CC[C@@]13CC(=O)[C@](C)(CC[C@@H]12)C3 |
| InChI | InChI=1S/C28H38N4O2/c1-25-12-10-22-26(2)13-9-20(24(34)30-16-19-7-5-4-6-8-19)27(3,18-31-32-29)21(26)11-14-28(22,17-25)15-23(25)33/h4-8,20-22H,9-18H2,1-3H3,(H,30,34)/t20?,21-,22-,25-,26+,27?,28+/m1/s1 |
| InChIKey | RHHAEBIVRAXOPC-GAQLJWOXSA-N |
| XLogP | 6.21 |
| TPSA | 94.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.64 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|