C27H31NO3 — CID 143830070
N-benzyl-10,13-dimethyl-3,11-dioxo-7,8,9,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthrene-17-carboxamide (PubChem CID 143830070) has the molecular formula C27H31NO3 and a molecular weight of 417.55 g/mol. Its IUPAC name is N-benzyl-10,13-dimethyl-3,11-dioxo-7,8,9,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthrene-17-carboxamide.
| Compound Name | N-benzyl-10,13-dimethyl-3,11-dioxo-7,8,9,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthrene-17-carboxamide |
|---|---|
| PubChem CID | 143830070 |
| Molecular Formula | C27H31NO3 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | N-benzyl-10,13-dimethyl-3,11-dioxo-7,8,9,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthrene-17-carboxamide |
| SMILES | CC12C=CC(=O)C=C1CCC1C2C(=O)CC2(C)C(C(=O)NCc3ccccc3)CCC12 |
| InChI | InChI=1S/C27H31NO3/c1-26-13-12-19(29)14-18(26)8-9-20-21-10-11-22(27(21,2)15-23(30)24(20)26)25(31)28-16-17-6-4-3-5-7-17/h3-7,12-14,20-22,24H,8-11,15-16H2,1-2H3,(H,28,31) |
| InChIKey | UODUZORFVBINOG-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |