C46H60O3P+ — CID 122180229
triphenyl-[8-[(1R,4S,5R,9S,10R,13S)-5,9,13-trimethyl-14-oxotetracyclo[11.2.1.01,10.04,9]hexadecane-5-carbonyl]oxyoctyl]phosphanium (PubChem CID 122180229) has the molecular formula C46H60O3P+ and a molecular weight of 691.96 g/mol. Its IUPAC name is triphenyl-[8-[(1R,4S,5R,9S,10R,13S)-5,9,13-trimethyl-14-oxotetracyclo[11.2.1.01,10.04,9]hexadecane-5-carbonyl]oxyoctyl]phosphanium.
| Compound Name | triphenyl-[8-[(1R,4S,5R,9S,10R,13S)-5,9,13-trimethyl-14-oxotetracyclo[11.2.1.01,10.04,9]hexadecane-5-carbonyl]oxyoctyl]phosphanium |
|---|---|
| PubChem CID | 122180229 |
| Molecular Formula | C46H60O3P+ |
| Molecular Weight | 691.96 g/mol |
| Exact Mass | 691.43 |
| IUPAC Name | triphenyl-[8-[(1R,4S,5R,9S,10R,13S)-5,9,13-trimethyl-14-oxotetracyclo[11.2.1.01,10.04,9]hexadecane-5-carbonyl]oxyoctyl]phosphanium |
| SMILES | C[C@@]12CC[C@@H]3[C@@](CC[C@H]4[C@@]3(C)CCC[C@@]4(C)C(=O)OCCCCCCCC[P+](c3ccccc3)(c3ccccc3)c3ccccc3)(CC1=O)C2 |
| InChI | InChI=1S/C46H60O3P/c1-43-30-26-40-44(2)28-19-29-45(3,39(44)27-31-46(40,35-43)34-41(43)47)42(48)49-32-17-6-4-5-7-18-33-50(36-20-11-8-12-21-36,37-22-13-9-14-23-37)38-24-15-10-16-25-38/h8-16,20-25,39-40H,4-7,17-19,26-35H2,1-3H3/q+1/t39-,40-,43-,44+,45+,46-/m0/s1 |
| InChIKey | JDULWSGGWIVMDW-JVSOITSBSA-N |
| XLogP | 10.24 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.96 |
| LogP ≤ 5 | 10.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|