C27H44N2O3 — CID 177393766
2-(4-methylpiperazin-1-yl)ethyl (1R,4S,5R,9S,10R,13S)-5,9,13-trimethyl-14-oxotetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate (PubChem CID 177393766) has the molecular formula C27H44N2O3 and a molecular weight of 444.66 g/mol. Its IUPAC name is 2-(4-methylpiperazin-1-yl)ethyl (1R,4S,5R,9S,10R,13S)-5,9,13-trimethyl-14-oxotetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate.
| Compound Name | 2-(4-methylpiperazin-1-yl)ethyl (1R,4S,5R,9S,10R,13S)-5,9,13-trimethyl-14-oxotetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate |
|---|---|
| PubChem CID | 177393766 |
| Molecular Formula | C27H44N2O3 |
| Molecular Weight | 444.66 g/mol |
| Exact Mass | 444.34 |
| IUPAC Name | 2-(4-methylpiperazin-1-yl)ethyl (1R,4S,5R,9S,10R,13S)-5,9,13-trimethyl-14-oxotetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate |
| SMILES | CN1CCN(CCOC(=O)[C@]2(C)CCC[C@@]3(C)[C@@H]4CC[C@@]5(C)C[C@]4(CC[C@@H]32)CC5=O)CC1 |
| InChI | InChI=1S/C27H44N2O3/c1-24-10-6-21-25(2)8-5-9-26(3,20(25)7-11-27(21,19-24)18-22(24)30)23(31)32-17-16-29-14-12-28(4)13-15-29/h20-21H,5-19H2,1-4H3/t20-,21-,24-,25+,26+,27-/m0/s1 |
| InChIKey | MOZMIROVQGUFHZ-FIVJYGDRSA-N |
| XLogP | 4.15 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.66 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |