C20H29KO3 — CID 72720706
potassium (1R,4S,5R,9S,10R,13S)-5,9,13-trimethyl-14-oxotetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate (PubChem CID 72720706) has the molecular formula C20H29KO3 and a molecular weight of 356.55 g/mol. Its IUPAC name is potassium (1R,4S,5R,9S,10R,13S)-5,9,13-trimethyl-14-oxotetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate.
| Compound Name | potassium (1R,4S,5R,9S,10R,13S)-5,9,13-trimethyl-14-oxotetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate |
|---|---|
| PubChem CID | 72720706 |
| Molecular Formula | C20H29KO3 |
| Molecular Weight | 356.55 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | potassium (1R,4S,5R,9S,10R,13S)-5,9,13-trimethyl-14-oxotetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate |
| SMILES | C[C@@]12CC[C@@H]3[C@@](CC[C@H]4[C@@]3(C)CCC[C@@]4(C)C(=O)[O-])(CC1=O)C2.[K+] |
| InChI | InChI=1S/C20H30O3.K/c1-17-9-5-14-18(2)7-4-8-19(3,16(22)23)13(18)6-10-20(14,12-17)11-15(17)21;/h13-14H,4-12H2,1-3H3,(H,22,23);/q;+1/p-1/t13-,14-,17-,18+,19+,20-;/m0./s1 |
| InChIKey | VUOCDPFVNMZGDZ-LTPIZSEESA-M |
| XLogP | 0.11 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.55 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |