C23H33NO2 — CID 176691804
N-[[(1R,5R,9S,13S)-5,9,13-trimethyl-14-oxo-5-tetracyclo[11.2.1.01,10.04,9]hexadecanyl]methyl]prop-2-ynamide (PubChem CID 176691804) has the molecular formula C23H33NO2 and a molecular weight of 355.52 g/mol. Its IUPAC name is N-[[(1R,5R,9S,13S)-5,9,13-trimethyl-14-oxo-5-tetracyclo[11.2.1.01,10.04,9]hexadecanyl]methyl]prop-2-ynamide.
| Compound Name | N-[[(1R,5R,9S,13S)-5,9,13-trimethyl-14-oxo-5-tetracyclo[11.2.1.01,10.04,9]hexadecanyl]methyl]prop-2-ynamide |
|---|---|
| PubChem CID | 176691804 |
| Molecular Formula | C23H33NO2 |
| Molecular Weight | 355.52 g/mol |
| Exact Mass | 355.25 |
| IUPAC Name | N-[[(1R,5R,9S,13S)-5,9,13-trimethyl-14-oxo-5-tetracyclo[11.2.1.01,10.04,9]hexadecanyl]methyl]prop-2-ynamide |
| SMILES | C#CC(=O)NC[C@]1(C)CCC[C@]2(C)C1CC[C@@]13CC(=O)[C@@](C)(CCC12)C3 |
| InChI | InChI=1S/C23H33NO2/c1-5-19(26)24-15-21(3)9-6-10-22(4)16(21)8-12-23-13-18(25)20(2,14-23)11-7-17(22)23/h1,16-17H,6-15H2,2-4H3,(H,24,26)/t16?,17?,20-,21-,22+,23-/m0/s1 |
| InChIKey | QHZFLGCAOUVYFV-SJLAEYMESA-N |
| XLogP | 4.11 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.52 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|