C23H33NO — CID 176691796
N-[[(1S,5R,9S,13R)-5,9-dimethyl-14-methylidene-5-tetracyclo[11.2.1.01,10.04,9]hexadecanyl]methyl]prop-2-ynamide (PubChem CID 176691796) has the molecular formula C23H33NO and a molecular weight of 339.52 g/mol. Its IUPAC name is N-[[(1S,5R,9S,13R)-5,9-dimethyl-14-methylidene-5-tetracyclo[11.2.1.01,10.04,9]hexadecanyl]methyl]prop-2-ynamide.
| Compound Name | N-[[(1S,5R,9S,13R)-5,9-dimethyl-14-methylidene-5-tetracyclo[11.2.1.01,10.04,9]hexadecanyl]methyl]prop-2-ynamide |
|---|---|
| PubChem CID | 176691796 |
| Molecular Formula | C23H33NO |
| Molecular Weight | 339.52 g/mol |
| Exact Mass | 339.26 |
| IUPAC Name | N-[[(1S,5R,9S,13R)-5,9-dimethyl-14-methylidene-5-tetracyclo[11.2.1.01,10.04,9]hexadecanyl]methyl]prop-2-ynamide |
| SMILES | C#CC(=O)NC[C@]1(C)CCC[C@]2(C)C1CC[C@]13CC(=C)[C@H](CCC12)C3 |
| InChI | InChI=1S/C23H33NO/c1-5-20(25)24-15-21(3)10-6-11-22(4)18(21)9-12-23-13-16(2)17(14-23)7-8-19(22)23/h1,17-19H,2,6-15H2,3-4H3,(H,24,25)/t17-,18?,19?,21+,22-,23-/m1/s1 |
| InChIKey | UJUFKHLSKNAOFU-UEEIJNAHSA-N |
| XLogP | 4.70 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.52 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|