C26H41NO — CID 24866275
(1S,4S,5R,9S,10R,13R)-N-cyclohexyl-5,9-dimethyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxamide (PubChem CID 24866275) has the molecular formula C26H41NO and a molecular weight of 383.62 g/mol. Its IUPAC name is (1S,4S,5R,9S,10R,13R)-N-cyclohexyl-5,9-dimethyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxamide.
| Compound Name | (1S,4S,5R,9S,10R,13R)-N-cyclohexyl-5,9-dimethyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxamide |
|---|---|
| PubChem CID | 24866275 |
| Molecular Formula | C26H41NO |
| Molecular Weight | 383.62 g/mol |
| Exact Mass | 383.32 |
| IUPAC Name | (1S,4S,5R,9S,10R,13R)-N-cyclohexyl-5,9-dimethyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxamide |
| SMILES | C=C1C[C@@]23CC[C@H]4[C@@](C)(CCC[C@@]4(C)C(=O)NC4CCCCC4)[C@@H]2CC[C@@H]1C3 |
| InChI | InChI=1S/C26H41NO/c1-18-16-26-15-12-21-24(2,22(26)11-10-19(18)17-26)13-7-14-25(21,3)23(28)27-20-8-5-4-6-9-20/h19-22H,1,4-17H2,2-3H3,(H,27,28)/t19-,21+,22+,24-,25-,26-/m1/s1 |
| InChIKey | KODQAXXCDAORIC-DRPPXZNZSA-N |
| XLogP | 6.40 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.62 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|