C20H32O3 — CID 177386264
[(1S,4S,5S,9S,10R,13R)-5,9-dimethyl-14-methylidene-5-tetracyclo[11.2.1.01,10.04,9]hexadecanyl]methanetriol (PubChem CID 177386264) has the molecular formula C20H32O3 and a molecular weight of 320.47 g/mol. Its IUPAC name is [(1S,4S,5S,9S,10R,13R)-5,9-dimethyl-14-methylidene-5-tetracyclo[11.2.1.01,10.04,9]hexadecanyl]methanetriol.
| Compound Name | [(1S,4S,5S,9S,10R,13R)-5,9-dimethyl-14-methylidene-5-tetracyclo[11.2.1.01,10.04,9]hexadecanyl]methanetriol |
|---|---|
| PubChem CID | 177386264 |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | [(1S,4S,5S,9S,10R,13R)-5,9-dimethyl-14-methylidene-5-tetracyclo[11.2.1.01,10.04,9]hexadecanyl]methanetriol |
| SMILES | C=C1C[C@@]23CC[C@H]4[C@@](C)(CCC[C@]4(C)C(O)(O)O)[C@@H]2CC[C@@H]1C3 |
| InChI | InChI=1S/C20H32O3/c1-13-11-19-10-7-15-17(2,16(19)6-5-14(13)12-19)8-4-9-18(15,3)20(21,22)23/h14-16,21-23H,1,4-12H2,2-3H3/t14-,15+,16+,17-,18+,19-/m1/s1 |
| InChIKey | YZTNIFLRJOICGN-BPCAWRKVSA-N |
| XLogP | 3.59 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|