C24H38 — CID 143402322
buta-1,3-diene;(1S,9R,13R)-5,5,9-trimethyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecane (PubChem CID 143402322) has the molecular formula C24H38 and a molecular weight of 326.57 g/mol. Its IUPAC name is buta-1,3-diene;(1S,9R,13R)-5,5,9-trimethyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecane.
| Compound Name | buta-1,3-diene;(1S,9R,13R)-5,5,9-trimethyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecane |
|---|---|
| PubChem CID | 143402322 |
| Molecular Formula | C24H38 |
| Molecular Weight | 326.57 g/mol |
| Exact Mass | 326.30 |
| IUPAC Name | buta-1,3-diene;(1S,9R,13R)-5,5,9-trimethyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecane |
| SMILES | C=C1C[C@@]23CCC4C(C)(C)CCC[C@@]4(C)C2CC[C@@H]1C3.C=CC=C |
| InChI | InChI=1S/C20H32.C4H6/c1-14-12-20-11-8-16-18(2,3)9-5-10-19(16,4)17(20)7-6-15(14)13-20;1-3-4-2/h15-17H,1,5-13H2,2-4H3;3-4H,1-2H2/t15-,16?,17?,19-,20-;/m1./s1 |
| InChIKey | LGMQIRYFJFVKRX-PIZVPHRQSA-N |
| XLogP | 7.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.57 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|