C22H34O — CID 123970168
1-[(1S,5R,9S,13R)-5,9-dimethyl-14-methylidene-5-tetracyclo[11.2.1.01,10.04,9]hexadecanyl]prop-2-en-1-ol (PubChem CID 123970168) has the molecular formula C22H34O and a molecular weight of 314.51 g/mol. Its IUPAC name is 1-[(1S,5R,9S,13R)-5,9-dimethyl-14-methylidene-5-tetracyclo[11.2.1.01,10.04,9]hexadecanyl]prop-2-en-1-ol.
| Compound Name | 1-[(1S,5R,9S,13R)-5,9-dimethyl-14-methylidene-5-tetracyclo[11.2.1.01,10.04,9]hexadecanyl]prop-2-en-1-ol |
|---|---|
| PubChem CID | 123970168 |
| Molecular Formula | C22H34O |
| Molecular Weight | 314.51 g/mol |
| Exact Mass | 314.26 |
| IUPAC Name | 1-[(1S,5R,9S,13R)-5,9-dimethyl-14-methylidene-5-tetracyclo[11.2.1.01,10.04,9]hexadecanyl]prop-2-en-1-ol |
| SMILES | C=CC(O)[C@]1(C)CCC[C@@]2(C)C3CC[C@@H]4C[C@@]3(CCC12)CC4=C |
| InChI | InChI=1S/C22H34O/c1-5-19(23)21(4)11-6-10-20(3)17(21)9-12-22-13-15(2)16(14-22)7-8-18(20)22/h5,16-19,23H,1-2,6-14H2,3-4H3/t16-,17?,18?,19?,20-,21-,22-/m1/s1 |
| InChIKey | VDYWTIBCMPGETF-GWILCDPLSA-N |
| XLogP | 5.50 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.51 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|