C24H36O4 — CID 162966857
(1S,4S,5R,9S,10R,13R)-9-methyl-14-methylidene-5-(2-methylpropanoyloxymethyl)tetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylic acid (PubChem CID 162966857) has the molecular formula C24H36O4 and a molecular weight of 388.55 g/mol. Its IUPAC name is (1S,4S,5R,9S,10R,13R)-9-methyl-14-methylidene-5-(2-methylpropanoyloxymethyl)tetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylic acid.
| Compound Name | (1S,4S,5R,9S,10R,13R)-9-methyl-14-methylidene-5-(2-methylpropanoyloxymethyl)tetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylic acid |
|---|---|
| PubChem CID | 162966857 |
| Molecular Formula | C24H36O4 |
| Molecular Weight | 388.55 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | (1S,4S,5R,9S,10R,13R)-9-methyl-14-methylidene-5-(2-methylpropanoyloxymethyl)tetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylic acid |
| SMILES | C=C1C[C@@]23CC[C@@H]4[C@](COC(=O)C(C)C)(C(=O)O)CCC[C@@]4(C)[C@@H]2CC[C@@H]1C3 |
| InChI | InChI=1S/C24H36O4/c1-15(2)20(25)28-14-24(21(26)27)10-5-9-22(4)18-7-6-17-13-23(18,12-16(17)3)11-8-19(22)24/h15,17-19H,3,5-14H2,1-2,4H3,(H,26,27)/t17-,18+,19+,22+,23-,24+/m1/s1 |
| InChIKey | BIFKLLRTOFMYSQ-UUFXIILRSA-N |
| XLogP | 5.22 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.55 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|