C24H36O5 — CID 101289623
4-[[(1S,4S,5R,6R,9S,10R,13R)-6-hydroxy-5,9-dimethyl-14-methylidene-5-tetracyclo[11.2.1.01,10.04,9]hexadecanyl]methoxy]-4-oxobutanoic acid (PubChem CID 101289623) has the molecular formula C24H36O5 and a molecular weight of 404.55 g/mol. Its IUPAC name is 4-[[(1S,4S,5R,6R,9S,10R,13R)-6-hydroxy-5,9-dimethyl-14-methylidene-5-tetracyclo[11.2.1.01,10.04,9]hexadecanyl]methoxy]-4-oxobutanoic acid.
| Compound Name | 4-[[(1S,4S,5R,6R,9S,10R,13R)-6-hydroxy-5,9-dimethyl-14-methylidene-5-tetracyclo[11.2.1.01,10.04,9]hexadecanyl]methoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 101289623 |
| Molecular Formula | C24H36O5 |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.26 |
| IUPAC Name | 4-[[(1S,4S,5R,6R,9S,10R,13R)-6-hydroxy-5,9-dimethyl-14-methylidene-5-tetracyclo[11.2.1.01,10.04,9]hexadecanyl]methoxy]-4-oxobutanoic acid |
| SMILES | C=C1C[C@@]23CC[C@@H]4[C@](C)(COC(=O)CCC(=O)O)[C@H](O)CC[C@@]4(C)[C@@H]2CC[C@@H]1C3 |
| InChI | InChI=1S/C24H36O5/c1-15-12-24-11-8-17-22(2,18(24)5-4-16(15)13-24)10-9-19(25)23(17,3)14-29-21(28)7-6-20(26)27/h16-19,25H,1,4-14H2,2-3H3,(H,26,27)/t16-,17+,18+,19-,22-,23+,24-/m1/s1 |
| InChIKey | QRCWTENDAKYOOH-BFUQEHHDSA-N |
| XLogP | 4.33 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|