C30H46N2O — CID 73355069
1-(1-adamantyl)-3-[(1S,4S,5R,9S,10R,13S)-5,9-dimethyl-14-methylidene-5-tetracyclo[11.2.1.01,10.04,9]hexadecanyl]urea (PubChem CID 73355069) has the molecular formula C30H46N2O and a molecular weight of 450.71 g/mol. Its IUPAC name is 1-(1-adamantyl)-3-[(1S,4S,5R,9S,10R,13S)-5,9-dimethyl-14-methylidene-5-tetracyclo[11.2.1.01,10.04,9]hexadecanyl]urea.
| Compound Name | 1-(1-adamantyl)-3-[(1S,4S,5R,9S,10R,13S)-5,9-dimethyl-14-methylidene-5-tetracyclo[11.2.1.01,10.04,9]hexadecanyl]urea |
|---|---|
| PubChem CID | 73355069 |
| Molecular Formula | C30H46N2O |
| Molecular Weight | 450.71 g/mol |
| Exact Mass | 450.36 |
| IUPAC Name | 1-(1-adamantyl)-3-[(1S,4S,5R,9S,10R,13S)-5,9-dimethyl-14-methylidene-5-tetracyclo[11.2.1.01,10.04,9]hexadecanyl]urea |
| SMILES | C=C1C[C@@]23CC[C@H]4[C@@](C)(CCC[C@@]4(C)NC(=O)NC45CC6CC(CC(C6)C4)C5)[C@@H]2CC[C@H]1C3 |
| InChI | InChI=1S/C30H46N2O/c1-19-14-29-10-7-24-27(2,25(29)6-5-23(19)18-29)8-4-9-28(24,3)31-26(33)32-30-15-20-11-21(16-30)13-22(12-20)17-30/h20-25H,1,4-18H2,2-3H3,(H2,31,32,33)/t20?,21?,22?,23-,24-,25-,27+,28+,29+,30?/m0/s1 |
| InChIKey | HJWWPMKMOZZXEP-LWYVQLAGSA-N |
| XLogP | 6.98 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.71 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|