C24H40N2O — CID 24866608
(1S,4S,5R,9S,10R,13R)-N-(4-aminobutyl)-5,9-dimethyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxamide (PubChem CID 24866608) has the molecular formula C24H40N2O and a molecular weight of 372.60 g/mol. Its IUPAC name is (1S,4S,5R,9S,10R,13R)-N-(4-aminobutyl)-5,9-dimethyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxamide.
| Compound Name | (1S,4S,5R,9S,10R,13R)-N-(4-aminobutyl)-5,9-dimethyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxamide |
|---|---|
| PubChem CID | 24866608 |
| Molecular Formula | C24H40N2O |
| Molecular Weight | 372.60 g/mol |
| Exact Mass | 372.31 |
| IUPAC Name | (1S,4S,5R,9S,10R,13R)-N-(4-aminobutyl)-5,9-dimethyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxamide |
| SMILES | C=C1C[C@@]23CC[C@H]4[C@@](C)(CCC[C@@]4(C)C(=O)NCCCCN)[C@@H]2CC[C@@H]1C3 |
| InChI | InChI=1S/C24H40N2O/c1-17-15-24-12-9-19-22(2,20(24)8-7-18(17)16-24)10-6-11-23(19,3)21(27)26-14-5-4-13-25/h18-20H,1,4-16,25H2,2-3H3,(H,26,27)/t18-,19+,20+,22-,23-,24-/m1/s1 |
| InChIKey | XAEMYWUNMIHXPL-MYJAMYHXSA-N |
| XLogP | 4.81 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.60 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|