C27H35BrO2 — CID 11583655
(4-bromophenyl)methyl (1S,4S,5R,9S,10R,13R)-5,9-dimethyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate (PubChem CID 11583655) has the molecular formula C27H35BrO2 and a molecular weight of 471.48 g/mol. Its IUPAC name is (4-bromophenyl)methyl (1S,4S,5R,9S,10R,13R)-5,9-dimethyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate.
| Compound Name | (4-bromophenyl)methyl (1S,4S,5R,9S,10R,13R)-5,9-dimethyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate |
|---|---|
| PubChem CID | 11583655 |
| Molecular Formula | C27H35BrO2 |
| Molecular Weight | 471.48 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | (4-bromophenyl)methyl (1S,4S,5R,9S,10R,13R)-5,9-dimethyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate |
| SMILES | C=C1C[C@@]23CC[C@H]4[C@@](C)(CCC[C@@]4(C)C(=O)OCc4ccc(Br)cc4)[C@@H]2CC[C@@H]1C3 |
| InChI | InChI=1S/C27H35BrO2/c1-18-15-27-14-11-22-25(2,23(27)10-7-20(18)16-27)12-4-13-26(22,3)24(29)30-17-19-5-8-21(28)9-6-19/h5-6,8-9,20,22-23H,1,4,7,10-17H2,2-3H3/t20-,22+,23+,25-,26-,27-/m1/s1 |
| InChIKey | FOJKIUDYEWWIEL-UNBZNDSDSA-N |
| XLogP | 7.46 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.48 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|