C30H46O3 — CID 170915364
[(1R,4S,6R)-4-hydroxy-3-methyl-6-propan-2-ylcyclohex-2-en-1-yl] (1S,4S,5R,9S,10R)-5,9-dimethyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate (PubChem CID 170915364) has the molecular formula C30H46O3 and a molecular weight of 454.70 g/mol. Its IUPAC name is [(1R,4S,6R)-4-hydroxy-3-methyl-6-propan-2-ylcyclohex-2-en-1-yl] (1S,4S,5R,9S,10R)-5,9-dimethyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate.
| Compound Name | [(1R,4S,6R)-4-hydroxy-3-methyl-6-propan-2-ylcyclohex-2-en-1-yl] (1S,4S,5R,9S,10R)-5,9-dimethyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate |
|---|---|
| PubChem CID | 170915364 |
| Molecular Formula | C30H46O3 |
| Molecular Weight | 454.70 g/mol |
| Exact Mass | 454.34 |
| IUPAC Name | [(1R,4S,6R)-4-hydroxy-3-methyl-6-propan-2-ylcyclohex-2-en-1-yl] (1S,4S,5R,9S,10R)-5,9-dimethyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate |
| SMILES | C=C1C[C@@]23CC[C@H]4[C@@](C)(CCC[C@@]4(C)C(=O)O[C@H]4C=C(C)[C@@H](O)C[C@@H]4C(C)C)[C@@H]2CCC1C3 |
| InChI | InChI=1S/C30H46O3/c1-18(2)22-15-23(31)19(3)14-24(22)33-27(32)29(6)12-7-11-28(5)25(29)10-13-30-16-20(4)21(17-30)8-9-26(28)30/h14,18,21-26,31H,4,7-13,15-17H2,1-3,5-6H3/t21?,22-,23+,24+,25+,26+,28-,29-,30-/m1/s1 |
| InChIKey | ZTKJIDAGDGTENO-LGOWFXEQSA-N |
| XLogP | 6.85 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.70 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|