C40H64 — CID 167590347
(1R,9R,13S)-5,5,9,13-tetramethyltetracyclo[11.2.1.01,10.04,9]hexadec-14-ene;(1S,9R,13R)-5,5,9-trimethyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecane (PubChem CID 167590347) has the molecular formula C40H64 and a molecular weight of 544.95 g/mol. Its IUPAC name is (1R,9R,13S)-5,5,9,13-tetramethyltetracyclo[11.2.1.01,10.04,9]hexadec-14-ene;(1S,9R,13R)-5,5,9-trimethyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecane.
| Compound Name | (1R,9R,13S)-5,5,9,13-tetramethyltetracyclo[11.2.1.01,10.04,9]hexadec-14-ene;(1S,9R,13R)-5,5,9-trimethyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecane |
|---|---|
| PubChem CID | 167590347 |
| Molecular Formula | C40H64 |
| Molecular Weight | 544.95 g/mol |
| Exact Mass | 544.50 |
| IUPAC Name | (1R,9R,13S)-5,5,9,13-tetramethyltetracyclo[11.2.1.01,10.04,9]hexadec-14-ene;(1S,9R,13R)-5,5,9-trimethyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecane |
| SMILES | C=C1C[C@@]23CCC4C(C)(C)CCC[C@@]4(C)C2CC[C@@H]1C3.CC1(C)CCC[C@]2(C)C1CC[C@@]13C=C[C@@](C)(CCC12)C3 |
| InChI | InChI=1S/2C20H32/c1-17(2)8-5-9-19(4)15(17)7-11-20-13-12-18(3,14-20)10-6-16(19)20;1-14-12-20-11-8-16-18(2,3)9-5-10-19(16,4)17(20)7-6-15(14)13-20/h12-13,15-16H,5-11,14H2,1-4H3;15-17H,1,5-13H2,2-4H3/t15?,16?,18-,19-,20+;15-,16?,17?,19-,20-/m11/s1 |
| InChIKey | IISFFGMCJUKQNI-ARRSWCJZSA-N |
| XLogP | 11.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.95 |
| LogP ≤ 5 | 11.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|