C19H30O3 — CID 66641649
(1R,4aR,8S,8aR)-8-(hydroxymethyl)-1,4a,8-trimethyl-3,4,6,7,8a,9,10,10a-octahydro-2H-phenanthrene-1-carboxylic acid (PubChem CID 66641649) has the molecular formula C19H30O3 and a molecular weight of 306.45 g/mol. Its IUPAC name is (1R,4aR,8S,8aR)-8-(hydroxymethyl)-1,4a,8-trimethyl-3,4,6,7,8a,9,10,10a-octahydro-2H-phenanthrene-1-carboxylic acid.
| Compound Name | (1R,4aR,8S,8aR)-8-(hydroxymethyl)-1,4a,8-trimethyl-3,4,6,7,8a,9,10,10a-octahydro-2H-phenanthrene-1-carboxylic acid |
|---|---|
| PubChem CID | 66641649 |
| Molecular Formula | C19H30O3 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.22 |
| IUPAC Name | (1R,4aR,8S,8aR)-8-(hydroxymethyl)-1,4a,8-trimethyl-3,4,6,7,8a,9,10,10a-octahydro-2H-phenanthrene-1-carboxylic acid |
| SMILES | C[C@]1(CO)CCC=C2[C@H]1CCC1[C@](C)(C(=O)O)CCC[C@@]21C |
| InChI | InChI=1S/C19H30O3/c1-17(12-20)9-4-6-14-13(17)7-8-15-18(14,2)10-5-11-19(15,3)16(21)22/h6,13,15,20H,4-5,7-12H2,1-3H3,(H,21,22)/t13-,15?,17-,18+,19-/m1/s1 |
| InChIKey | VLAOGEBVIVKWON-QNBCLJFBSA-N |
| XLogP | 4.01 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|