C19H29IO2 — CID 66641680
methyl (1R,4aR,8S,10aS)-8-iodo-1,4a,8-trimethyl-3,4,6,7,8a,9,10,10a-octahydro-2H-phenanthrene-1-carboxylate (PubChem CID 66641680) has the molecular formula C19H29IO2 and a molecular weight of 416.34 g/mol. Its IUPAC name is methyl (1R,4aR,8S,10aS)-8-iodo-1,4a,8-trimethyl-3,4,6,7,8a,9,10,10a-octahydro-2H-phenanthrene-1-carboxylate.
| Compound Name | methyl (1R,4aR,8S,10aS)-8-iodo-1,4a,8-trimethyl-3,4,6,7,8a,9,10,10a-octahydro-2H-phenanthrene-1-carboxylate |
|---|---|
| PubChem CID | 66641680 |
| Molecular Formula | C19H29IO2 |
| Molecular Weight | 416.34 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | methyl (1R,4aR,8S,10aS)-8-iodo-1,4a,8-trimethyl-3,4,6,7,8a,9,10,10a-octahydro-2H-phenanthrene-1-carboxylate |
| SMILES | COC(=O)[C@]1(C)CCC[C@@]2(C)C3=CCC[C@](C)(I)C3CC[C@H]12 |
| InChI | InChI=1S/C19H29IO2/c1-17-10-6-11-18(2,16(21)22-4)15(17)9-8-14-13(17)7-5-12-19(14,3)20/h7,14-15H,5-6,8-12H2,1-4H3/t14?,15-,17-,18+,19-/m0/s1 |
| InChIKey | CWVRYCYBYZIDKY-ROVVYWQMSA-N |
| XLogP | 5.30 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.34 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|